C13H18Br2N2O — CID 97258604
3-[[(1R)-1-(2,4-dibromophenyl)ethyl]amino]-2,2-dimethylpropanamide (PubChem CID 97258604) has the molecular formula C13H18Br2N2O and a molecular weight of 378.11 g/mol. Its IUPAC name is 3-[[(1R)-1-(2,4-dibromophenyl)ethyl]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[(1R)-1-(2,4-dibromophenyl)ethyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 97258604 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 3-[[(1R)-1-(2,4-dibromophenyl)ethyl]amino]-2,2-dimethylpropanamide |
| SMILES | C[C@@H](NCC(C)(C)C(N)=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H18Br2N2O/c1-8(17-7-13(2,3)12(16)18)10-5-4-9(14)6-11(10)15/h4-6,8,17H,7H2,1-3H3,(H2,16,18)/t8-/m1/s1 |
| InChIKey | ZXNDYPQWCVBVTD-MRVPVSSYSA-N |
| XLogP | 3.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |