C11H13BrF3NO — CID 114127458
N-[(2-bromo-3-fluorophenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine (PubChem CID 114127458) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is N-[(2-bromo-3-fluorophenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine.
| Compound Name | N-[(2-bromo-3-fluorophenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 114127458 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | N-[(2-bromo-3-fluorophenyl)methyl]-2-(2,2-difluoroethoxy)ethanamine |
| SMILES | Fc1cccc(CNCCOCC(F)F)c1Br |
| InChI | InChI=1S/C11H13BrF3NO/c12-11-8(2-1-3-9(11)13)6-16-4-5-17-7-10(14)15/h1-3,10,16H,4-7H2 |
| InChIKey | CDQUNBVIHNAIJZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|