C14H21F2NO3 — CID 103080982
2-(2,2-difluoroethoxy)-N-[(3-ethoxy-2-methoxyphenyl)methyl]ethanamine (PubChem CID 103080982) has the molecular formula C14H21F2NO3 and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(3-ethoxy-2-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(3-ethoxy-2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103080982 |
| Molecular Formula | C14H21F2NO3 |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(3-ethoxy-2-methoxyphenyl)methyl]ethanamine |
| SMILES | CCOc1cccc(CNCCOCC(F)F)c1OC |
| InChI | InChI=1S/C14H21F2NO3/c1-3-20-12-6-4-5-11(14(12)18-2)9-17-7-8-19-10-13(15)16/h4-6,13,17H,3,7-10H2,1-2H3 |
| InChIKey | UZICYEDAEALHRO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|