C12H17F2NO — CID 103081199
2-(2,2-difluoroethoxy)-N-[(2-methylphenyl)methyl]ethanamine (PubChem CID 103081199) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(2-methylphenyl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(2-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103081199 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(2-methylphenyl)methyl]ethanamine |
| SMILES | Cc1ccccc1CNCCOCC(F)F |
| InChI | InChI=1S/C12H17F2NO/c1-10-4-2-3-5-11(10)8-15-6-7-16-9-12(13)14/h2-5,12,15H,6-9H2,1H3 |
| InChIKey | TUZOGUBMCORWKF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|