C13H19F2NO — CID 82006882
N-[[2-(2,2-difluoroethoxymethyl)phenyl]methyl]propan-1-amine (PubChem CID 82006882) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is N-[[2-(2,2-difluoroethoxymethyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2,2-difluoroethoxymethyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82006882 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[[2-(2,2-difluoroethoxymethyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccccc1COCC(F)F |
| InChI | InChI=1S/C13H19F2NO/c1-2-7-16-8-11-5-3-4-6-12(11)9-17-10-13(14)15/h3-6,13,16H,2,7-10H2,1H3 |
| InChIKey | COUHJVISIXERHU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|