C15H18F2N2O — CID 82005872
N-[[2-(2,2-difluoroethoxy)quinolin-4-yl]methyl]propan-1-amine (PubChem CID 82005872) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[[2-(2,2-difluoroethoxy)quinolin-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2,2-difluoroethoxy)quinolin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82005872 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[[2-(2,2-difluoroethoxy)quinolin-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(OCC(F)F)nc2ccccc12 |
| InChI | InChI=1S/C15H18F2N2O/c1-2-7-18-9-11-8-15(20-10-14(16)17)19-13-6-4-3-5-12(11)13/h3-6,8,14,18H,2,7,9-10H2,1H3 |
| InChIKey | ONLOEXNYHLGJCH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|