C11H15BrF2N2O — CID 82005379
N-[[5-bromo-2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 82005379) has the molecular formula C11H15BrF2N2O and a molecular weight of 309.15 g/mol. Its IUPAC name is N-[[5-bromo-2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[5-bromo-2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82005379 |
| Molecular Formula | C11H15BrF2N2O |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | N-[[5-bromo-2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Br)cnc1OCC(F)F |
| InChI | InChI=1S/C11H15BrF2N2O/c1-2-3-15-5-8-4-9(12)6-16-11(8)17-7-10(13)14/h4,6,10,15H,2-3,5,7H2,1H3 |
| InChIKey | QGEWHRSMXAAKMW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|