C8H7BrClF2NO — CID 82006550
5-bromo-3-(chloromethyl)-2-(2,2-difluoroethoxy)pyridine (PubChem CID 82006550) has the molecular formula C8H7BrClF2NO and a molecular weight of 286.50 g/mol. Its IUPAC name is 5-bromo-3-(chloromethyl)-2-(2,2-difluoroethoxy)pyridine.
| Compound Name | 5-bromo-3-(chloromethyl)-2-(2,2-difluoroethoxy)pyridine |
|---|---|
| PubChem CID | 82006550 |
| Molecular Formula | C8H7BrClF2NO |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 284.94 |
| IUPAC Name | 5-bromo-3-(chloromethyl)-2-(2,2-difluoroethoxy)pyridine |
| SMILES | FC(F)COc1ncc(Br)cc1CCl |
| InChI | InChI=1S/C8H7BrClF2NO/c9-6-1-5(2-10)8(13-3-6)14-4-7(11)12/h1,3,7H,2,4H2 |
| InChIKey | OBTIKHACQWKFHZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|