C16H19BrN2O2 — CID 62297990
N-[[5-bromo-2-(3-methoxyphenoxy)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 62297990) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is N-[[5-bromo-2-(3-methoxyphenoxy)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[5-bromo-2-(3-methoxyphenoxy)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62297990 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-[[5-bromo-2-(3-methoxyphenoxy)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Br)cnc1Oc1cccc(OC)c1 |
| InChI | InChI=1S/C16H19BrN2O2/c1-3-7-18-10-12-8-13(17)11-19-16(12)21-15-6-4-5-14(9-15)20-2/h4-6,8-9,11,18H,3,7,10H2,1-2H3 |
| InChIKey | LRRCHIAEANSQOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|