C11H14BrF3N2O — CID 62291897
N-[[5-bromo-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 62291897) has the molecular formula C11H14BrF3N2O and a molecular weight of 327.14 g/mol. Its IUPAC name is N-[[5-bromo-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[5-bromo-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62291897 |
| Molecular Formula | C11H14BrF3N2O |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-[[5-bromo-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Br)cnc1OCC(F)(F)F |
| InChI | InChI=1S/C11H14BrF3N2O/c1-2-3-16-5-8-4-9(12)6-17-10(8)18-7-11(13,14)15/h4,6,16H,2-3,5,7H2,1H3 |
| InChIKey | ALQSOWRLLXTUQH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|