C16H25BrN2O — CID 63490204
N-[(5-bromo-2-cycloheptyloxy-3-pyridinyl)methyl]propan-1-amine (PubChem CID 63490204) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is N-[(5-bromo-2-cycloheptyloxy-3-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-2-cycloheptyloxy-3-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63490204 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[(5-bromo-2-cycloheptyloxy-3-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Br)cnc1OC1CCCCCC1 |
| InChI | InChI=1S/C16H25BrN2O/c1-2-9-18-11-13-10-14(17)12-19-16(13)20-15-7-5-3-4-6-8-15/h10,12,15,18H,2-9,11H2,1H3 |
| InChIKey | UYYWNBKOLJBRFT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|