C17H28BrN3 — CID 63487902
5-bromo-N-cyclohexyl-N-ethyl-3-(propylaminomethyl)pyridin-2-amine (PubChem CID 63487902) has the molecular formula C17H28BrN3 and a molecular weight of 354.34 g/mol. Its IUPAC name is 5-bromo-N-cyclohexyl-N-ethyl-3-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-cyclohexyl-N-ethyl-3-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63487902 |
| Molecular Formula | C17H28BrN3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 5-bromo-N-cyclohexyl-N-ethyl-3-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1cc(Br)cnc1N(CC)C1CCCCC1 |
| InChI | InChI=1S/C17H28BrN3/c1-3-10-19-12-14-11-15(18)13-20-17(14)21(4-2)16-8-6-5-7-9-16/h11,13,16,19H,3-10,12H2,1-2H3 |
| InChIKey | SNSGBKSFBRPLOD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|