C14H22BrN3O — CID 82754864
5-bromo-N-methyl-N-(oxolan-3-yl)-3-(propylaminomethyl)pyridin-2-amine (PubChem CID 82754864) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-(oxolan-3-yl)-3-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-methyl-N-(oxolan-3-yl)-3-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 82754864 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 5-bromo-N-methyl-N-(oxolan-3-yl)-3-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1cc(Br)cnc1N(C)C1CCOC1 |
| InChI | InChI=1S/C14H22BrN3O/c1-3-5-16-8-11-7-12(15)9-17-14(11)18(2)13-4-6-19-10-13/h7,9,13,16H,3-6,8,10H2,1-2H3 |
| InChIKey | KDKMVRSMEIZOPW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|