C16H27BrN4 — CID 63274618
5-bromo-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-3-(propylaminomethyl)pyridin-2-amine (PubChem CID 63274618) has the molecular formula C16H27BrN4 and a molecular weight of 355.32 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-3-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-3-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63274618 |
| Molecular Formula | C16H27BrN4 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 5-bromo-N-methyl-N-[(1-methylpyrrolidin-3-yl)methyl]-3-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1cc(Br)cnc1N(C)CC1CCN(C)C1 |
| InChI | InChI=1S/C16H27BrN4/c1-4-6-18-9-14-8-15(17)10-19-16(14)21(3)12-13-5-7-20(2)11-13/h8,10,13,18H,4-7,9,11-12H2,1-3H3 |
| InChIKey | PWYZFLONSAIGPS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|