C11H17F2N3O — CID 83195410
N-[[2-(2,2-difluoroethoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine (PubChem CID 83195410) has the molecular formula C11H17F2N3O and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[[2-(2,2-difluoroethoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2,2-difluoroethoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 83195410 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[[2-(2,2-difluoroethoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(OCC(F)F)nc1C |
| InChI | InChI=1S/C11H17F2N3O/c1-3-4-14-5-9-6-15-11(16-8(9)2)17-7-10(12)13/h6,10,14H,3-5,7H2,1-2H3 |
| InChIKey | ZVBGDYRWCAQMRP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|