C15H17F2N3O — CID 83187362
N-[[2-(3,5-difluorophenoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine (PubChem CID 83187362) has the molecular formula C15H17F2N3O and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[[2-(3,5-difluorophenoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,5-difluorophenoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 83187362 |
| Molecular Formula | C15H17F2N3O |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[[2-(3,5-difluorophenoxy)-4-methylpyrimidin-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(Oc2cc(F)cc(F)c2)nc1C |
| InChI | InChI=1S/C15H17F2N3O/c1-3-4-18-8-11-9-19-15(20-10(11)2)21-14-6-12(16)5-13(17)7-14/h5-7,9,18H,3-4,8H2,1-2H3 |
| InChIKey | WPHSVEHSTAXFGL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|