C10H15F2NO2 — CID 103080992
2-(2,2-difluoroethoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine (PubChem CID 103080992) has the molecular formula C10H15F2NO2 and a molecular weight of 219.23 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103080992 |
| Molecular Formula | C10H15F2NO2 |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine |
| SMILES | Cc1ccc(CNCCOCC(F)F)o1 |
| InChI | InChI=1S/C10H15F2NO2/c1-8-2-3-9(15-8)6-13-4-5-14-7-10(11)12/h2-3,10,13H,4-7H2,1H3 |
| InChIKey | UKJLLDIPMSOEQC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|