C12H22N2O — CID 62525254
N'-butan-2-yl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine (PubChem CID 62525254) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N'-butan-2-yl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62525254 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N'-butan-2-yl-N-[(5-methylfuran-2-yl)methyl]ethane-1,2-diamine |
| SMILES | CCC(C)NCCNCc1ccc(C)o1 |
| InChI | InChI=1S/C12H22N2O/c1-4-10(2)14-8-7-13-9-12-6-5-11(3)15-12/h5-6,10,13-14H,4,7-9H2,1-3H3 |
| InChIKey | GJIXTNNBMUFZFT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|