C14H15F2NO2 — CID 119124887
2-(3,4-difluorophenoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine (PubChem CID 119124887) has the molecular formula C14H15F2NO2 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine.
| Compound Name | 2-(3,4-difluorophenoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 119124887 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-N-[(5-methylfuran-2-yl)methyl]ethanamine |
| SMILES | Cc1ccc(CNCCOc2ccc(F)c(F)c2)o1 |
| InChI | InChI=1S/C14H15F2NO2/c1-10-2-3-12(19-10)9-17-6-7-18-11-4-5-13(15)14(16)8-11/h2-5,8,17H,6-7,9H2,1H3 |
| InChIKey | GLJYRIWZIZNDGJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|