C13H8F6N2O — CID 133372468
N-[2-(3,4-difluorophenoxy)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133372468) has the molecular formula C13H8F6N2O and a molecular weight of 322.21 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133372468 |
| Molecular Formula | C13H8F6N2O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Fc1ccc(OCCNc2c(F)c(F)nc(F)c2F)cc1F |
| InChI | InChI=1S/C13H8F6N2O/c14-7-2-1-6(5-8(7)15)22-4-3-20-11-9(16)12(18)21-13(19)10(11)17/h1-2,5H,3-4H2,(H,20,21) |
| InChIKey | XQYCALVOSZMQKG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|