C14H12F2N4OS2 — CID 133291768
N-[2-(3,4-difluorophenoxy)ethyl]-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-amine (PubChem CID 133291768) has the molecular formula C14H12F2N4OS2 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133291768 |
| Molecular Formula | C14H12F2N4OS2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CSc1nc2ncnc(NCCOc3ccc(F)c(F)c3)c2s1 |
| InChI | InChI=1S/C14H12F2N4OS2/c1-22-14-20-13-11(23-14)12(18-7-19-13)17-4-5-21-8-2-3-9(15)10(16)6-8/h2-3,6-7H,4-5H2,1H3,(H,17,18,19) |
| InChIKey | PIFZUFIYACWCEM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|