C12H15N5OS2 — CID 133305779
N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]cyclopropanecarboxamide (PubChem CID 133305779) has the molecular formula C12H15N5OS2 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 133305779 |
| Molecular Formula | C12H15N5OS2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[2-[(2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethyl]cyclopropanecarboxamide |
| SMILES | CSc1nc2ncnc(NCCNC(=O)C3CC3)c2s1 |
| InChI | InChI=1S/C12H15N5OS2/c1-19-12-17-10-8(20-12)9(15-6-16-10)13-4-5-14-11(18)7-2-3-7/h6-7H,2-5H2,1H3,(H,14,18)(H,13,15,16) |
| InChIKey | YAHCPRREJPFFAY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|