C18H23N3O — CID 3206675
N-[2-[(3,6,7-trimethylquinolin-2-yl)amino]ethyl]cyclopropanecarboxamide (PubChem CID 3206675) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[2-[(3,6,7-trimethylquinolin-2-yl)amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(3,6,7-trimethylquinolin-2-yl)amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3206675 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[2-[(3,6,7-trimethylquinolin-2-yl)amino]ethyl]cyclopropanecarboxamide |
| SMILES | Cc1cc2cc(C)c(NCCNC(=O)C3CC3)nc2cc1C |
| InChI | InChI=1S/C18H23N3O/c1-11-8-15-9-13(3)17(21-16(15)10-12(11)2)19-6-7-20-18(22)14-4-5-14/h8-10,14H,4-7H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | RZKBXUBYMSJJQH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|