C16H20N3O+ — CID 7402612
N-[2-[(3-methylquinolin-1-ium-2-yl)amino]ethyl]cyclopropanecarboxamide (PubChem CID 7402612) has the molecular formula C16H20N3O+ and a molecular weight of 270.36 g/mol. Its IUPAC name is N-[2-[(3-methylquinolin-1-ium-2-yl)amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(3-methylquinolin-1-ium-2-yl)amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 7402612 |
| Molecular Formula | C16H20N3O+ |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N-[2-[(3-methylquinolin-1-ium-2-yl)amino]ethyl]cyclopropanecarboxamide |
| SMILES | Cc1cc2ccccc2[nH+]c1NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C16H19N3O/c1-11-10-13-4-2-3-5-14(13)19-15(11)17-8-9-18-16(20)12-6-7-12/h2-5,10,12H,6-9H2,1H3,(H,17,19)(H,18,20)/p+1 |
| InChIKey | CYBHDNQEZUSOLT-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 55.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|