C18H21N4O2+ — CID 7434779
N-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]cyclobutanecarboxamide (PubChem CID 7434779) has the molecular formula C18H21N4O2+ and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 7434779 |
| Molecular Formula | C18H21N4O2+ |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[2-[(3-cyano-6-methoxyquinolin-1-ium-2-yl)amino]ethyl]cyclobutanecarboxamide |
| SMILES | COc1ccc2[nH+]c(NCCNC(=O)C3CCC3)c(C#N)cc2c1 |
| InChI | InChI=1S/C18H20N4O2/c1-24-15-5-6-16-13(10-15)9-14(11-19)17(22-16)20-7-8-21-18(23)12-3-2-4-12/h5-6,9-10,12H,2-4,7-8H2,1H3,(H,20,22)(H,21,23)/p+1 |
| InChIKey | VQTNSEIRWQRHKV-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|