C20H21N4O3S+ — CID 7219503
N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 7219503) has the molecular formula C20H21N4O3S+ and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7219503 |
| Molecular Formula | C20H21N4O3S+ |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | CCOc1ccc2[nH+]c(NCCNS(=O)(=O)c3ccccc3)c(C#N)cc2c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-2-27-17-8-9-19-15(13-17)12-16(14-21)20(24-19)22-10-11-23-28(25,26)18-6-4-3-5-7-18/h3-9,12-13,23H,2,10-11H2,1H3,(H,22,24)/p+1 |
| InChIKey | PETCLLRIGWVYDA-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|