C19H24N5O3+ — CID 7391212
N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]morpholine-4-carboxamide (PubChem CID 7391212) has the molecular formula C19H24N5O3+ and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 7391212 |
| Molecular Formula | C19H24N5O3+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[2-[(3-cyano-6-ethoxyquinolin-1-ium-2-yl)amino]ethyl]morpholine-4-carboxamide |
| SMILES | CCOc1ccc2[nH+]c(NCCNC(=O)N3CCOCC3)c(C#N)cc2c1 |
| InChI | InChI=1S/C19H23N5O3/c1-2-27-16-3-4-17-14(12-16)11-15(13-20)18(23-17)21-5-6-22-19(25)24-7-9-26-10-8-24/h3-4,11-12H,2,5-10H2,1H3,(H,21,23)(H,22,25)/p+1 |
| InChIKey | VMEJHKMBDTVTAP-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|