C18H26N3O2+ — CID 7221290
N-[2-[(6-ethoxy-3-methylquinolin-1-ium-2-yl)amino]ethyl]-2-methylpropanamide (PubChem CID 7221290) has the molecular formula C18H26N3O2+ and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[2-[(6-ethoxy-3-methylquinolin-1-ium-2-yl)amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[(6-ethoxy-3-methylquinolin-1-ium-2-yl)amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 7221290 |
| Molecular Formula | C18H26N3O2+ |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-[2-[(6-ethoxy-3-methylquinolin-1-ium-2-yl)amino]ethyl]-2-methylpropanamide |
| SMILES | CCOc1ccc2[nH+]c(NCCNC(=O)C(C)C)c(C)cc2c1 |
| InChI | InChI=1S/C18H25N3O2/c1-5-23-15-6-7-16-14(11-15)10-13(4)17(21-16)19-8-9-20-18(22)12(2)3/h6-7,10-12H,5,8-9H2,1-4H3,(H,19,21)(H,20,22)/p+1 |
| InChIKey | NVSSWJXYQKJTMY-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|