C17H27N3O5 — CID 155893558
N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide (PubChem CID 155893558) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide.
| Compound Name | N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 155893558 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[2-[[2-hydroxy-3-(4-methoxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide |
| SMILES | COc1ccc(OCC(O)CNCCNC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H27N3O5/c1-23-15-2-4-16(5-3-15)25-13-14(21)12-18-6-7-19-17(22)20-8-10-24-11-9-20/h2-5,14,18,21H,6-13H2,1H3,(H,19,22) |
| InChIKey | KDIKXVULGNFRQC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|