C10H20N2O4 — CID 103876112
N-(3-hydroxy-4-methoxybutyl)morpholine-4-carboxamide (PubChem CID 103876112) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(3-hydroxy-4-methoxybutyl)morpholine-4-carboxamide.
| Compound Name | N-(3-hydroxy-4-methoxybutyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 103876112 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-(3-hydroxy-4-methoxybutyl)morpholine-4-carboxamide |
| SMILES | COCC(O)CCNC(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H20N2O4/c1-15-8-9(13)2-3-11-10(14)12-4-6-16-7-5-12/h9,13H,2-8H2,1H3,(H,11,14) |
| InChIKey | LWVKZMMDIIFCEL-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |