C26H46N4O6 — CID 19133409
1-[4-[2-hydroxy-3-(3-morpholin-4-ylpropylamino)propoxy]phenoxy]-3-(3-morpholin-4-ylpropylamino)propan-2-ol (PubChem CID 19133409) has the molecular formula C26H46N4O6 and a molecular weight of 510.68 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-(3-morpholin-4-ylpropylamino)propoxy]phenoxy]-3-(3-morpholin-4-ylpropylamino)propan-2-ol.
| Compound Name | 1-[4-[2-hydroxy-3-(3-morpholin-4-ylpropylamino)propoxy]phenoxy]-3-(3-morpholin-4-ylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 19133409 |
| Molecular Formula | C26H46N4O6 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | 1-[4-[2-hydroxy-3-(3-morpholin-4-ylpropylamino)propoxy]phenoxy]-3-(3-morpholin-4-ylpropylamino)propan-2-ol |
| SMILES | OC(CNCCCN1CCOCC1)COc1ccc(OCC(O)CNCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H46N4O6/c31-23(19-27-7-1-9-29-11-15-33-16-12-29)21-35-25-3-5-26(6-4-25)36-22-24(32)20-28-8-2-10-30-13-17-34-18-14-30/h3-6,23-24,27-28,31-32H,1-2,7-22H2 |
| InChIKey | WJBNIYGBZDERSE-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|