C16H26N2O3 — CID 125487728
(2R)-1-(4-morpholin-4-ylphenoxy)-3-(propan-2-ylamino)propan-2-ol (PubChem CID 125487728) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (2R)-1-(4-morpholin-4-ylphenoxy)-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | (2R)-1-(4-morpholin-4-ylphenoxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 125487728 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (2R)-1-(4-morpholin-4-ylphenoxy)-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NC[C@@H](O)COc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H26N2O3/c1-13(2)17-11-15(19)12-21-16-5-3-14(4-6-16)18-7-9-20-10-8-18/h3-6,13,15,17,19H,7-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | PFCVEZFESZAQHW-OAHLLOKOSA-N |
| XLogP | 1.26 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|