C34H52N6O14 — CID 91825958
bis(N-[2-[[(2R)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide);oxalic acid (PubChem CID 91825958) has the molecular formula C34H52N6O14 and a molecular weight of 768.82 g/mol. Its IUPAC name is bis(N-[2-[[(2R)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide);oxalic acid.
| Compound Name | bis(N-[2-[[(2R)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide);oxalic acid |
|---|---|
| PubChem CID | 91825958 |
| Molecular Formula | C34H52N6O14 |
| Molecular Weight | 768.82 g/mol |
| Exact Mass | 768.35 |
| IUPAC Name | bis(N-[2-[[(2R)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]morpholine-4-carboxamide);oxalic acid |
| SMILES | O=C(NCCNC[C@@H](O)COc1ccc(O)cc1)N1CCOCC1.O=C(NCCNC[C@@H](O)COc1ccc(O)cc1)N1CCOCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C16H25N3O5.C2H2O4/c2*20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19;3-1(4)2(5)6/h2*1-4,14,17,20-21H,5-12H2,(H,18,22);(H,3,4)(H,5,6)/t2*14-;/m11./s1 |
| InChIKey | SFESMVIUBTVCJQ-XZPBZCASSA-N |
| XLogP | -1.32 |
| TPSA | 281.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.82 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|