C31H47N3O5 — CID 18173860
4-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]-N-octylpiperidine-1-carboxamide (PubChem CID 18173860) has the molecular formula C31H47N3O5 and a molecular weight of 541.73 g/mol. Its IUPAC name is 4-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]-N-octylpiperidine-1-carboxamide.
| Compound Name | 4-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]-N-octylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 18173860 |
| Molecular Formula | C31H47N3O5 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.35 |
| IUPAC Name | 4-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]-N-octylpiperidine-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N1CCC(Oc2ccc(CCNCC(O)COc3ccc(O)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H47N3O5/c1-2-3-4-5-6-7-19-33-31(37)34-21-17-30(18-22-34)39-29-12-8-25(9-13-29)16-20-32-23-27(36)24-38-28-14-10-26(35)11-15-28/h8-15,27,30,32,35-36H,2-7,16-24H2,1H3,(H,33,37) |
| InChIKey | MBPXTPNHXFRXMH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|