C30H37FN4O5 — CID 10166207
N-[(4-fluorophenyl)methyl]-4-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethoxy]anilino]piperidine-1-carboxamide (PubChem CID 10166207) has the molecular formula C30H37FN4O5 and a molecular weight of 552.65 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethoxy]anilino]piperidine-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethoxy]anilino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 10166207 |
| Molecular Formula | C30H37FN4O5 |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethoxy]anilino]piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCC(Nc2ccc(OCCNC[C@H](O)COc3ccc(O)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H37FN4O5/c31-23-3-1-22(2-4-23)19-33-30(38)35-16-13-25(14-17-35)34-24-5-9-28(10-6-24)39-18-15-32-20-27(37)21-40-29-11-7-26(36)8-12-29/h1-12,25,27,32,34,36-37H,13-21H2,(H,33,38)/t27-/m0/s1 |
| InChIKey | KWTFDYOASIVPQZ-MHZLTWQESA-N |
| XLogP | 3.73 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|