C48H58FN5O5Si — CID 70031812
4-[4-[2-[[(2S)-3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]-N-[3-(4-fluoroanilino)-3-oxopropyl]piperidine-1-carboxamide (PubChem CID 70031812) has the molecular formula C48H58FN5O5Si and a molecular weight of 832.11 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]-N-[3-(4-fluoroanilino)-3-oxopropyl]piperidine-1-carboxamide.
| Compound Name | 4-[4-[2-[[(2S)-3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]-N-[3-(4-fluoroanilino)-3-oxopropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 70031812 |
| Molecular Formula | C48H58FN5O5Si |
| Molecular Weight | 832.11 g/mol |
| Exact Mass | 831.42 |
| IUPAC Name | 4-[4-[2-[[(2S)-3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]-N-[3-(4-fluoroanilino)-3-oxopropyl]piperidine-1-carboxamide |
| SMILES | CC(C)(C)[Si](Oc1ccc(OC[C@@H](O)CNCCc2ccc(NC3CCN(C(=O)NCCC(=O)Nc4ccc(F)cc4)CC3)cc2)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H58FN5O5Si/c1-48(2,3)60(44-10-6-4-7-11-44,45-12-8-5-9-13-45)59-43-24-22-42(23-25-43)58-35-41(55)34-50-30-26-36-14-18-38(19-15-36)52-40-28-32-54(33-29-40)47(57)51-31-27-46(56)53-39-20-16-37(49)17-21-39/h4-25,40-41,50,52,55H,26-35H2,1-3H3,(H,51,57)(H,53,56)/t41-/m0/s1 |
| InChIKey | ZEZKZJBUYCXCMY-RWYGWLOXSA-N |
| XLogP | 6.95 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.11 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|