C48H55N3O5SSi — CID 70168365
[4-[4-[2-[[3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]piperidin-1-yl]-(3-methoxy-1-benzothiophen-2-yl)methanone (PubChem CID 70168365) has the molecular formula C48H55N3O5SSi and a molecular weight of 814.14 g/mol. Its IUPAC name is [4-[4-[2-[[3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]piperidin-1-yl]-(3-methoxy-1-benzothiophen-2-yl)methanone.
| Compound Name | [4-[4-[2-[[3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]piperidin-1-yl]-(3-methoxy-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 70168365 |
| Molecular Formula | C48H55N3O5SSi |
| Molecular Weight | 814.14 g/mol |
| Exact Mass | 813.36 |
| IUPAC Name | [4-[4-[2-[[3-[4-[tert-butyl(diphenyl)silyl]oxyphenoxy]-2-hydroxypropyl]amino]ethyl]anilino]piperidin-1-yl]-(3-methoxy-1-benzothiophen-2-yl)methanone |
| SMILES | COc1c(C(=O)N2CCC(Nc3ccc(CCNCC(O)COc4ccc(O[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)cc4)cc3)CC2)sc2ccccc12 |
| InChI | InChI=1S/C48H55N3O5SSi/c1-48(2,3)58(41-13-7-5-8-14-41,42-15-9-6-10-16-42)56-40-25-23-39(24-26-40)55-34-38(52)33-49-30-27-35-19-21-36(22-20-35)50-37-28-31-51(32-29-37)47(53)46-45(54-4)43-17-11-12-18-44(43)57-46/h5-26,37-38,49-50,52H,27-34H2,1-4H3 |
| InChIKey | WCSDXDHUGFNDHS-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.14 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|