C31H47FN4O3 — CID 10302477
4-[4-[2-[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]anilino]-N-octylpiperidine-1-carboxamide (PubChem CID 10302477) has the molecular formula C31H47FN4O3 and a molecular weight of 542.74 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]anilino]-N-octylpiperidine-1-carboxamide.
| Compound Name | 4-[4-[2-[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]anilino]-N-octylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 10302477 |
| Molecular Formula | C31H47FN4O3 |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | 4-[4-[2-[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]amino]ethyl]anilino]-N-octylpiperidine-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N1CCC(Nc2ccc(CCNC[C@H](O)COc3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H47FN4O3/c1-2-3-4-5-6-7-19-34-31(38)36-21-17-28(18-22-36)35-27-12-8-25(9-13-27)16-20-33-23-29(37)24-39-30-14-10-26(32)11-15-30/h8-15,28-29,33,35,37H,2-7,16-24H2,1H3,(H,34,38)/t29-/m0/s1 |
| InChIKey | LPHITUVHZSJYON-LJAQVGFWSA-N |
| XLogP | 5.34 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|