C28H42N4O6S — CID 10231394
1-hexyl-3-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea (PubChem CID 10231394) has the molecular formula C28H42N4O6S and a molecular weight of 562.73 g/mol. Its IUPAC name is 1-hexyl-3-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea.
| Compound Name | 1-hexyl-3-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea |
|---|---|
| PubChem CID | 10231394 |
| Molecular Formula | C28H42N4O6S |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 1-hexyl-3-[4-[4-[[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]methyl]piperidin-1-yl]sulfonylphenyl]urea |
| SMILES | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)N2CCC(CNC[C@H](O)COc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H42N4O6S/c1-2-3-4-5-16-30-28(35)31-23-6-12-27(13-7-23)39(36,37)32-17-14-22(15-18-32)19-29-20-25(34)21-38-26-10-8-24(33)9-11-26/h6-13,22,25,29,33-34H,2-5,14-21H2,1H3,(H2,30,31,35)/t25-/m0/s1 |
| InChIKey | OFYUUXIYRPQSFG-VWLOTQADSA-N |
| XLogP | 3.52 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|