C27H40N4O6S — CID 10230922
1-hexyl-3-[4-[4-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]piperidin-1-yl]sulfonylphenyl]urea (PubChem CID 10230922) has the molecular formula C27H40N4O6S and a molecular weight of 548.71 g/mol. Its IUPAC name is 1-hexyl-3-[4-[4-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]piperidin-1-yl]sulfonylphenyl]urea.
| Compound Name | 1-hexyl-3-[4-[4-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]piperidin-1-yl]sulfonylphenyl]urea |
|---|---|
| PubChem CID | 10230922 |
| Molecular Formula | C27H40N4O6S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 1-hexyl-3-[4-[4-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]piperidin-1-yl]sulfonylphenyl]urea |
| SMILES | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)N2CCC(NC[C@H](O)COc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H40N4O6S/c1-2-3-4-5-16-28-27(34)30-22-6-12-26(13-7-22)38(35,36)31-17-14-21(15-18-31)29-19-24(33)20-37-25-10-8-23(32)9-11-25/h6-13,21,24,29,32-33H,2-5,14-20H2,1H3,(H2,28,30,34)/t24-/m0/s1 |
| InChIKey | JBKNIJVKNBLHCV-DEOSSOPVSA-N |
| XLogP | 3.28 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|