C32H44N6O4S — CID 22220209
1-hexyl-3-[4-[[4-[4-[[2-hydroxy-2-(6-methyl-3-pyridinyl)ethyl]amino]piperidin-1-yl]phenyl]sulfamoyl]phenyl]urea (PubChem CID 22220209) has the molecular formula C32H44N6O4S and a molecular weight of 608.81 g/mol. Its IUPAC name is 1-hexyl-3-[4-[[4-[4-[[2-hydroxy-2-(6-methyl-3-pyridinyl)ethyl]amino]piperidin-1-yl]phenyl]sulfamoyl]phenyl]urea.
| Compound Name | 1-hexyl-3-[4-[[4-[4-[[2-hydroxy-2-(6-methyl-3-pyridinyl)ethyl]amino]piperidin-1-yl]phenyl]sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 22220209 |
| Molecular Formula | C32H44N6O4S |
| Molecular Weight | 608.81 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | 1-hexyl-3-[4-[[4-[4-[[2-hydroxy-2-(6-methyl-3-pyridinyl)ethyl]amino]piperidin-1-yl]phenyl]sulfamoyl]phenyl]urea |
| SMILES | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(N3CCC(NCC(O)c4ccc(C)nc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H44N6O4S/c1-3-4-5-6-19-33-32(40)36-27-11-15-30(16-12-27)43(41,42)37-28-9-13-29(14-10-28)38-20-17-26(18-21-38)35-23-31(39)25-8-7-24(2)34-22-25/h7-16,22,26,31,35,37,39H,3-6,17-21,23H2,1-2H3,(H2,33,36,40) |
| InChIKey | NTAXMQQLVCCJDV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.81 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|