C23H32N4O4S — CID 137435031
N-heptyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]acetamide (PubChem CID 137435031) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is N-heptyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]acetamide.
| Compound Name | N-heptyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 137435031 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N-heptyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]acetamide |
| SMILES | CCCCCCCNC(=O)CNC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H32N4O4S/c1-3-4-5-6-7-16-24-22(28)17-25-23(29)26-19-10-12-20(13-11-19)27-32(30,31)21-14-8-18(2)9-15-21/h8-15,27H,3-7,16-17H2,1-2H3,(H,24,28)(H2,25,26,29) |
| InChIKey | UHQBLWQLQVHGCG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|