C29H42N4O4S — CID 137435061
(2R)-3-cyclohexyl-N-hexyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]propanamide (PubChem CID 137435061) has the molecular formula C29H42N4O4S and a molecular weight of 542.75 g/mol. Its IUPAC name is (2R)-3-cyclohexyl-N-hexyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]propanamide.
| Compound Name | (2R)-3-cyclohexyl-N-hexyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 137435061 |
| Molecular Formula | C29H42N4O4S |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | (2R)-3-cyclohexyl-N-hexyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]propanamide |
| SMILES | CCCCCCNC(=O)[C@@H](CC1CCCCC1)NC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H42N4O4S/c1-3-4-5-9-20-30-28(34)27(21-23-10-7-6-8-11-23)32-29(35)31-24-14-16-25(17-15-24)33-38(36,37)26-18-12-22(2)13-19-26/h12-19,23,27,33H,3-11,20-21H2,1-2H3,(H,30,34)(H2,31,32,35)/t27-/m1/s1 |
| InChIKey | ULFYXBFOTRJYHA-HHHXNRCGSA-N |
| XLogP | 5.95 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|