C28H34N4O4S — CID 137435183
(2R)-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-pentyl-3-phenylpropanamide (PubChem CID 137435183) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is (2R)-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-pentyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-pentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 137435183 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | (2R)-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-pentyl-3-phenylpropanamide |
| SMILES | CCCCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H34N4O4S/c1-3-4-8-19-29-27(33)26(20-22-9-6-5-7-10-22)31-28(34)30-23-13-15-24(16-14-23)32-37(35,36)25-17-11-21(2)12-18-25/h5-7,9-18,26,32H,3-4,8,19-20H2,1-2H3,(H,29,33)(H2,30,31,34)/t26-/m1/s1 |
| InChIKey | ZOWFCSJLXVLPPV-AREMUKBSSA-N |
| XLogP | 4.84 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|