C24H34N4O4S — CID 137435186
2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-octylacetamide (PubChem CID 137435186) has the molecular formula C24H34N4O4S and a molecular weight of 474.63 g/mol. Its IUPAC name is 2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-octylacetamide.
| Compound Name | 2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-octylacetamide |
|---|---|
| PubChem CID | 137435186 |
| Molecular Formula | C24H34N4O4S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CNC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H34N4O4S/c1-3-4-5-6-7-8-17-25-23(29)18-26-24(30)27-20-11-13-21(14-12-20)28-33(31,32)22-15-9-19(2)10-16-22/h9-16,28H,3-8,17-18H2,1-2H3,(H,25,29)(H2,26,27,30) |
| InChIKey | ASSFAUICOFSLQY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|