C26H38N4O4S — CID 137435097
(2R)-N-hexyl-4-methyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]pentanamide (PubChem CID 137435097) has the molecular formula C26H38N4O4S and a molecular weight of 502.68 g/mol. Its IUPAC name is (2R)-N-hexyl-4-methyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]pentanamide.
| Compound Name | (2R)-N-hexyl-4-methyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]pentanamide |
|---|---|
| PubChem CID | 137435097 |
| Molecular Formula | C26H38N4O4S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (2R)-N-hexyl-4-methyl-2-[[4-[(4-methylphenyl)sulfonylamino]phenyl]carbamoylamino]pentanamide |
| SMILES | CCCCCCNC(=O)[C@@H](CC(C)C)NC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H38N4O4S/c1-5-6-7-8-17-27-25(31)24(18-19(2)3)29-26(32)28-21-11-13-22(14-12-21)30-35(33,34)23-15-9-20(4)10-16-23/h9-16,19,24,30H,5-8,17-18H2,1-4H3,(H,27,31)(H2,28,29,32)/t24-/m1/s1 |
| InChIKey | KLFYCQSSXQPBOY-XMMPIXPASA-N |
| XLogP | 5.03 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|