C34H45ClN4O4S — CID 137435044
(2S)-2-[[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]carbamoylamino]-3-(4-chlorophenyl)-N-octylpropanamide (PubChem CID 137435044) has the molecular formula C34H45ClN4O4S and a molecular weight of 641.28 g/mol. Its IUPAC name is (2S)-2-[[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]carbamoylamino]-3-(4-chlorophenyl)-N-octylpropanamide.
| Compound Name | (2S)-2-[[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]carbamoylamino]-3-(4-chlorophenyl)-N-octylpropanamide |
|---|---|
| PubChem CID | 137435044 |
| Molecular Formula | C34H45ClN4O4S |
| Molecular Weight | 641.28 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | (2S)-2-[[4-[(4-tert-butylphenyl)sulfonylamino]phenyl]carbamoylamino]-3-(4-chlorophenyl)-N-octylpropanamide |
| SMILES | CCCCCCCCNC(=O)[C@H](Cc1ccc(Cl)cc1)NC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H45ClN4O4S/c1-5-6-7-8-9-10-23-36-32(40)31(24-25-11-15-27(35)16-12-25)38-33(41)37-28-17-19-29(20-18-28)39-44(42,43)30-21-13-26(14-22-30)34(2,3)4/h11-22,31,39H,5-10,23-24H2,1-4H3,(H,36,40)(H2,37,38,41)/t31-/m0/s1 |
| InChIKey | RSGHJLAZRLTTSF-HKBQPEDESA-N |
| XLogP | 7.65 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.28 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|