C22H29FN2O3S — CID 20967531
2-[(4-fluorophenyl)sulfonylamino]-N-heptyl-3-phenylpropanamide (PubChem CID 20967531) has the molecular formula C22H29FN2O3S and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-heptyl-3-phenylpropanamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-heptyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 20967531 |
| Molecular Formula | C22H29FN2O3S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-heptyl-3-phenylpropanamide |
| SMILES | CCCCCCCNC(=O)C(Cc1ccccc1)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H29FN2O3S/c1-2-3-4-5-9-16-24-22(26)21(17-18-10-7-6-8-11-18)25-29(27,28)20-14-12-19(23)13-15-20/h6-8,10-15,21,25H,2-5,9,16-17H2,1H3,(H,24,26) |
| InChIKey | IDJHDFXLHUDJAW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|