C25H34N4O7S — CID 174453151
ethyl 2-amino-3-[4-[4-[[(2R)-2-hydroxy-2-(4-hydroxy-3-methylsulfonylphenyl)ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate (PubChem CID 174453151) has the molecular formula C25H34N4O7S and a molecular weight of 534.64 g/mol. Its IUPAC name is ethyl 2-amino-3-[4-[4-[[(2R)-2-hydroxy-2-(4-hydroxy-3-methylsulfonylphenyl)ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[4-[4-[[(2R)-2-hydroxy-2-(4-hydroxy-3-methylsulfonylphenyl)ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 174453151 |
| Molecular Formula | C25H34N4O7S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | ethyl 2-amino-3-[4-[4-[[(2R)-2-hydroxy-2-(4-hydroxy-3-methylsulfonylphenyl)ethyl]amino]piperidin-1-yl]anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)Nc1ccc(N2CCC(NC[C@H](O)c3ccc(O)c(S(C)(=O)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C25H34N4O7S/c1-3-36-25(33)23(26)24(32)28-18-5-7-19(8-6-18)29-12-10-17(11-13-29)27-15-21(31)16-4-9-20(30)22(14-16)37(2,34)35/h4-9,14,17,21,23,27,30-31H,3,10-13,15,26H2,1-2H3,(H,28,32)/t21-,23?/m0/s1 |
| InChIKey | ASTJFAARZREAIW-BBQAJUCSSA-N |
| XLogP | 0.92 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|