C24H30N4O6S2 — CID 22220546
N-[5-[2-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide (PubChem CID 22220546) has the molecular formula C24H30N4O6S2 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[5-[2-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[2-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 22220546 |
| Molecular Formula | C24H30N4O6S2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | N-[5-[2-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]piperidin-4-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(O)CNC2CCN(c3ccc(CC4SC(=O)NC4=O)cc3)CC2)ccc1O |
| InChI | InChI=1S/C24H30N4O6S2/c1-36(33,34)27-19-13-16(4-7-20(19)29)21(30)14-25-17-8-10-28(11-9-17)18-5-2-15(3-6-18)12-22-23(31)26-24(32)35-22/h2-7,13,17,21-22,25,27,29-30H,8-12,14H2,1H3,(H,26,31,32) |
| InChIKey | LYCJVGDAEAJXKC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 148.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|